![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01. Comedus Adventurus.mp3 | 2016-09-27 23:22 | 3.7M | |
| 02. Aisles Of Smiles.mp3 | 2016-09-27 23:23 | 3.3M | |
| 03. Spectacular Spy Theme.mp3 | 2016-09-27 23:23 | 3.7M | |
| 04. Happy Traffic.mp3 | 2016-09-27 23:23 | 3.6M | |
| 05. A Fistful Of Gunsmoke.mp3 | 2016-09-27 23:23 | 4.2M | |
| 06. I Kitsch U Not.mp3 | 2016-09-27 23:25 | 3.6M | |
| 07. Perfectville.mp3 | 2016-09-27 23:24 | 4.0M | |
| 08. Tango Smarm.mp3 | 2016-09-27 23:23 | 3.6M | |
| 09. Quiz Show Clock.mp3 | 2016-09-27 23:24 | 3.6M | |
| 10. Halloweenies.mp3 | 2016-09-27 23:25 | 3.6M | |
| 11. Big Night Out.mp3 | 2016-09-27 23:24 | 3.6M | |
| 12. Three Dumb Mice.mp3 | 2016-09-27 23:24 | 3.6M | |
| 13. Cartoon Mania.mp3 | 2016-09-27 23:25 | 3.7M | |
| 14. Hillbilly Hoedown.mp3 | 2016-09-27 23:25 | 3.9M | |
| 15. Street Waif Suite.mp3 | 2016-09-27 23:26 | 2.7M | |
| 16. Whistling Military Heroes.mp3 | 2016-09-27 23:26 | 3.6M | |
| 17. Matinee Melodies.mp3 | 2016-09-27 23:25 | 3.6M | |
| 18. Slapstick Soliloquy.mp3 | 2016-09-27 23:26 | 3.6M | |
| 19. To The Rescue.mp3 | 2016-09-27 23:26 | 3.6M | |
| 20. Victory Cavalcade.mp3 | 2016-09-27 23:26 | 3.7M | |